C23H35ClN4O5 — CID 118224114
tert-butyl (3R)-3-[2-chloro-6-nitro-3-(2-pyrrolidin-1-ylethoxy)anilino]azepane-1-carboxylate (PubChem CID 118224114) has the molecular formula C23H35ClN4O5 and a molecular weight of 483.01 g/mol. Its IUPAC name is tert-butyl (3R)-3-[2-chloro-6-nitro-3-(2-pyrrolidin-1-ylethoxy)anilino]azepane-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[2-chloro-6-nitro-3-(2-pyrrolidin-1-ylethoxy)anilino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 118224114 |
| Molecular Formula | C23H35ClN4O5 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | tert-butyl (3R)-3-[2-chloro-6-nitro-3-(2-pyrrolidin-1-ylethoxy)anilino]azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@@H](Nc2c([N+](=O)[O-])ccc(OCCN3CCCC3)c2Cl)C1 |
| InChI | InChI=1S/C23H35ClN4O5/c1-23(2,3)33-22(29)27-13-5-4-8-17(16-27)25-21-18(28(30)31)9-10-19(20(21)24)32-15-14-26-11-6-7-12-26/h9-10,17,25H,4-8,11-16H2,1-3H3/t17-/m1/s1 |
| InChIKey | LIDIRSTVVGWORH-QGZVFWFLSA-N |
| XLogP | 4.92 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|