C11H17N5 — CID 145120459
4-N-cyclopentyl-5-ethanimidoylpyrimidine-4,6-diamine (PubChem CID 145120459) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 4-N-cyclopentyl-5-ethanimidoylpyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclopentyl-5-ethanimidoylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 145120459 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 4-N-cyclopentyl-5-ethanimidoylpyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\C)c1c(N)ncnc1NC1CCCC1 |
| InChI | InChI=1S/C11H17N5/c1-7(12)9-10(13)14-6-15-11(9)16-8-4-2-3-5-8/h6,8,12H,2-5H2,1H3,(H3,13,14,15,16)/b12-7+ |
| InChIKey | WMAGVDPEVHORNY-KPKJPENVSA-N |
| XLogP | 1.80 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|