C18H20N6S — CID 145372051
1H-indol-3-yl 4-amino-6-(cyclopentylamino)pyrimidine-5-carboximidothioate (PubChem CID 145372051) has the molecular formula C18H20N6S and a molecular weight of 352.47 g/mol. Its IUPAC name is 1H-indol-3-yl 4-amino-6-(cyclopentylamino)pyrimidine-5-carboximidothioate.
| Compound Name | 1H-indol-3-yl 4-amino-6-(cyclopentylamino)pyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 145372051 |
| Molecular Formula | C18H20N6S |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1H-indol-3-yl 4-amino-6-(cyclopentylamino)pyrimidine-5-carboximidothioate |
| SMILES | [H]/N=C(/Sc1c[nH]c2ccccc12)c1c(N)ncnc1NC1CCCC1 |
| InChI | InChI=1S/C18H20N6S/c19-16-15(18(23-10-22-16)24-11-5-1-2-6-11)17(20)25-14-9-21-13-8-4-3-7-12(13)14/h3-4,7-11,20-21H,1-2,5-6H2,(H3,19,22,23,24)/b20-17+ |
| InChIKey | AJBKUCVFWJBSHC-LVZFUZTISA-N |
| XLogP | 4.01 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|