C18H20N6S — CID 91258608
4-N-cyclopentyl-5-(2-methyl-1,3-benzothiazole-6-carboximidoyl)pyrimidine-4,6-diamine (PubChem CID 91258608) has the molecular formula C18H20N6S and a molecular weight of 352.47 g/mol. Its IUPAC name is 4-N-cyclopentyl-5-(2-methyl-1,3-benzothiazole-6-carboximidoyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclopentyl-5-(2-methyl-1,3-benzothiazole-6-carboximidoyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 91258608 |
| Molecular Formula | C18H20N6S |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-N-cyclopentyl-5-(2-methyl-1,3-benzothiazole-6-carboximidoyl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc2nc(C)sc2c1)c1c(N)ncnc1NC1CCCC1 |
| InChI | InChI=1S/C18H20N6S/c1-10-23-13-7-6-11(8-14(13)25-10)16(19)15-17(20)21-9-22-18(15)24-12-4-2-3-5-12/h6-9,12,19H,2-5H2,1H3,(H3,20,21,22,24)/b19-16+ |
| InChIKey | KTSKJAHLCUCJNT-KNTRCKAVSA-N |
| XLogP | 3.75 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|