C21H21FN6 — CID 144832479
4-N-(2,3-dihydro-1H-inden-2-yl)-5-[4-fluoro-3-(methylamino)benzenecarboximidoyl]pyrimidine-4,6-diamine (PubChem CID 144832479) has the molecular formula C21H21FN6 and a molecular weight of 376.44 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1H-inden-2-yl)-5-[4-fluoro-3-(methylamino)benzenecarboximidoyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,3-dihydro-1H-inden-2-yl)-5-[4-fluoro-3-(methylamino)benzenecarboximidoyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 144832479 |
| Molecular Formula | C21H21FN6 |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 4-N-(2,3-dihydro-1H-inden-2-yl)-5-[4-fluoro-3-(methylamino)benzenecarboximidoyl]pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc(F)c(NC)c1)c1c(N)ncnc1NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C21H21FN6/c1-25-17-10-14(6-7-16(17)22)19(23)18-20(24)26-11-27-21(18)28-15-8-12-4-2-3-5-13(12)9-15/h2-7,10-11,15,23,25H,8-9H2,1H3,(H3,24,26,27,28)/b23-19+ |
| InChIKey | PGCIAJVAJZWDET-FCDQGJHFSA-N |
| XLogP | 3.24 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|