About 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol
3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol (PubChem CID 144832497) has the molecular formula C20H18FN5O
and a molecular weight of 363.40 g/mol. Its IUPAC name is 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol.
Molecular Properties
| Compound Name | 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol |
| PubChem CID | 144832497 |
| Molecular Formula | C20H18FN5O |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol |
| SMILES | [H]/N=C(\c1cc(O)cc(F)c1)c1c(N)ncnc1NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C20H18FN5O/c21-14-5-13(8-16(27)9-14)18(22)17-19(23)24-10-25-20(17)26-15-6-11-3-1-2-4-12(11)7-15/h1-5,8-10,15,22,27H,6-7H2,(H3,23,24,25,26)/b22-18+ |
| InChIKey | MDUZDEWVOCJXHD-RELWKKBWSA-N |
| XLogP | 2.90 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol?
The IUPAC name of 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol (CID 144832497) is 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol.
What is the SMILES notation for 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol?
The canonical SMILES for 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol is [H]/N=C(\c1cc(O)cc(F)c1)c1c(N)ncnc1NC1Cc2ccccc2C1.
What is the InChIKey of 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol?
The InChIKey is MDUZDEWVOCJXHD-RELWKKBWSA-N. The full InChI is InChI=1S/C20H18FN5O/c21-14-5-13(8-16(27)9-14)18(22)17-19(23)24-10-25-20(17)26-15-6-11-3-1-2-4-12(11)7-15/h1-5,8-10,15,22,27H,6-7H2,(H3,23,24,25,26)/b22-18+.
What are the key properties of 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol?
3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol has a molecular weight of 363.40 g/mol, XLogP of 2.90, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-5-fluorophenol is sourced from PubChem (CID 144832497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).