C20H18ClN5O — CID 144832436
3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-4-chlorophenol (PubChem CID 144832436) has the molecular formula C20H18ClN5O and a molecular weight of 379.85 g/mol. Its IUPAC name is 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-4-chlorophenol.
| Compound Name | 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-4-chlorophenol |
|---|---|
| PubChem CID | 144832436 |
| Molecular Formula | C20H18ClN5O |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 3-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidine-5-carboximidoyl]-4-chlorophenol |
| SMILES | [H]/N=C(\c1cc(O)ccc1Cl)c1c(N)ncnc1NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C20H18ClN5O/c21-16-6-5-14(27)9-15(16)18(22)17-19(23)24-10-25-20(17)26-13-7-11-3-1-2-4-12(11)8-13/h1-6,9-10,13,22,27H,7-8H2,(H3,23,24,25,26)/b22-18+ |
| InChIKey | XKKRLMHEAHPESF-RELWKKBWSA-N |
| XLogP | 3.41 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|