C17H19N5O — CID 144832490
(E)-4-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-4-iminobut-2-en-1-ol (PubChem CID 144832490) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is (E)-4-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-4-iminobut-2-en-1-ol.
| Compound Name | (E)-4-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-4-iminobut-2-en-1-ol |
|---|---|
| PubChem CID | 144832490 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (E)-4-[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-4-iminobut-2-en-1-ol |
| SMILES | [H]/N=C(\C=C\CO)c1c(N)ncnc1NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H19N5O/c18-14(6-3-7-23)15-16(19)20-10-21-17(15)22-13-8-11-4-1-2-5-12(11)9-13/h1-6,10,13,18,23H,7-9H2,(H3,19,20,21,22)/b6-3+,18-14+ |
| InChIKey | CIUPGODZEWSHQH-AYJNVWPBSA-N |
| XLogP | 1.55 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|