C29H25FN6O — CID 144832418
5-(6-fluoro-5-phenoxyindole-1-carboximidoyl)-4-N-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidine-4,6-diamine (PubChem CID 144832418) has the molecular formula C29H25FN6O and a molecular weight of 492.56 g/mol. Its IUPAC name is 5-(6-fluoro-5-phenoxyindole-1-carboximidoyl)-4-N-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 5-(6-fluoro-5-phenoxyindole-1-carboximidoyl)-4-N-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 144832418 |
| Molecular Formula | C29H25FN6O |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 5-(6-fluoro-5-phenoxyindole-1-carboximidoyl)-4-N-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(/c1c(N)ncnc1NC1CCc2ccccc2C1)n1ccc2cc(Oc3ccccc3)c(F)cc21 |
| InChI | InChI=1S/C29H25FN6O/c30-23-16-24-20(15-25(23)37-22-8-2-1-3-9-22)12-13-36(24)28(32)26-27(31)33-17-34-29(26)35-21-11-10-18-6-4-5-7-19(18)14-21/h1-9,12-13,15-17,21,32H,10-11,14H2,(H3,31,33,34,35)/b32-28- |
| InChIKey | VZBDVVKYJDZHBP-BLCKFSMSSA-N |
| XLogP | 5.79 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|