C20H17F2N5O — CID 144832280
3-[4-amino-6-[(5-fluoro-2,3-dihydro-1H-inden-2-yl)amino]pyrimidine-5-carboximidoyl]-5-fluorophenol (PubChem CID 144832280) has the molecular formula C20H17F2N5O and a molecular weight of 381.39 g/mol. Its IUPAC name is 3-[4-amino-6-[(5-fluoro-2,3-dihydro-1H-inden-2-yl)amino]pyrimidine-5-carboximidoyl]-5-fluorophenol.
| Compound Name | 3-[4-amino-6-[(5-fluoro-2,3-dihydro-1H-inden-2-yl)amino]pyrimidine-5-carboximidoyl]-5-fluorophenol |
|---|---|
| PubChem CID | 144832280 |
| Molecular Formula | C20H17F2N5O |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 3-[4-amino-6-[(5-fluoro-2,3-dihydro-1H-inden-2-yl)amino]pyrimidine-5-carboximidoyl]-5-fluorophenol |
| SMILES | [H]/N=C(\c1cc(O)cc(F)c1)c1c(N)ncnc1NC1Cc2ccc(F)cc2C1 |
| InChI | InChI=1S/C20H17F2N5O/c21-13-2-1-10-5-15(6-11(10)3-13)27-20-17(19(24)25-9-26-20)18(23)12-4-14(22)8-16(28)7-12/h1-4,7-9,15,23,28H,5-6H2,(H3,24,25,26,27)/b23-18+ |
| InChIKey | BLFGWYKQZKAGLW-PTGBLXJZSA-N |
| XLogP | 3.04 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|