C21H22FN7O — CID 144842470
N-[2-[[6-amino-5-[4-fluoro-3-(methylamino)benzenecarboximidoyl]pyrimidin-4-yl]amino]ethyl]-N-phenylformamide (PubChem CID 144842470) has the molecular formula C21H22FN7O and a molecular weight of 407.45 g/mol. Its IUPAC name is N-[2-[[6-amino-5-[4-fluoro-3-(methylamino)benzenecarboximidoyl]pyrimidin-4-yl]amino]ethyl]-N-phenylformamide.
| Compound Name | N-[2-[[6-amino-5-[4-fluoro-3-(methylamino)benzenecarboximidoyl]pyrimidin-4-yl]amino]ethyl]-N-phenylformamide |
|---|---|
| PubChem CID | 144842470 |
| Molecular Formula | C21H22FN7O |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[2-[[6-amino-5-[4-fluoro-3-(methylamino)benzenecarboximidoyl]pyrimidin-4-yl]amino]ethyl]-N-phenylformamide |
| SMILES | [H]/N=C(\c1ccc(F)c(NC)c1)c1c(N)ncnc1NCCN(C=O)c1ccccc1 |
| InChI | InChI=1S/C21H22FN7O/c1-25-17-11-14(7-8-16(17)22)19(23)18-20(24)27-12-28-21(18)26-9-10-29(13-30)15-5-3-2-4-6-15/h2-8,11-13,23,25H,9-10H2,1H3,(H3,24,26,27,28)/b23-19+ |
| InChIKey | LWHKUJJGWOBWGS-FCDQGJHFSA-N |
| XLogP | 2.73 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|