C21H25N5O — CID 145130112
5-(6-ethoxynaphthalene-2-carboximidoyl)-4-N-(2-methylpropyl)pyrimidine-4,6-diamine (PubChem CID 145130112) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 5-(6-ethoxynaphthalene-2-carboximidoyl)-4-N-(2-methylpropyl)pyrimidine-4,6-diamine.
| Compound Name | 5-(6-ethoxynaphthalene-2-carboximidoyl)-4-N-(2-methylpropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 145130112 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 5-(6-ethoxynaphthalene-2-carboximidoyl)-4-N-(2-methylpropyl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc2cc(OCC)ccc2c1)c1c(N)ncnc1NCC(C)C |
| InChI | InChI=1S/C21H25N5O/c1-4-27-17-8-7-14-9-16(6-5-15(14)10-17)19(22)18-20(23)25-12-26-21(18)24-11-13(2)3/h5-10,12-13,22H,4,11H2,1-3H3,(H3,23,24,25,26)/b22-19+ |
| InChIKey | OPRBDXYWQGKIOG-ZBJSNUHESA-N |
| XLogP | 4.09 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|