C19H19N5O — CID 145184739
5-[4-(4-ethylphenoxy)benzenecarboximidoyl]pyrimidine-4,6-diamine (PubChem CID 145184739) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 5-[4-(4-ethylphenoxy)benzenecarboximidoyl]pyrimidine-4,6-diamine.
| Compound Name | 5-[4-(4-ethylphenoxy)benzenecarboximidoyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 145184739 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 5-[4-(4-ethylphenoxy)benzenecarboximidoyl]pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc(Oc2ccc(CC)cc2)cc1)c1c(N)ncnc1N |
| InChI | InChI=1S/C19H19N5O/c1-2-12-3-7-14(8-4-12)25-15-9-5-13(6-10-15)17(20)16-18(21)23-11-24-19(16)22/h3-11,20H,2H2,1H3,(H4,21,22,23,24)/b20-17+ |
| InChIKey | UPPPQDLRLWEMFW-LVZFUZTISA-N |
| XLogP | 3.41 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|