C19H19N5O3 — CID 145184743
5-[4-(3,4-dimethoxyphenoxy)benzenecarboximidoyl]pyrimidine-4,6-diamine (PubChem CID 145184743) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 5-[4-(3,4-dimethoxyphenoxy)benzenecarboximidoyl]pyrimidine-4,6-diamine.
| Compound Name | 5-[4-(3,4-dimethoxyphenoxy)benzenecarboximidoyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 145184743 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 5-[4-(3,4-dimethoxyphenoxy)benzenecarboximidoyl]pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc(Oc2ccc(OC)c(OC)c2)cc1)c1c(N)ncnc1N |
| InChI | InChI=1S/C19H19N5O3/c1-25-14-8-7-13(9-15(14)26-2)27-12-5-3-11(4-6-12)17(20)16-18(21)23-10-24-19(16)22/h3-10,20H,1-2H3,(H4,21,22,23,24)/b20-17+ |
| InChIKey | STHGAEOCURSSIF-LVZFUZTISA-N |
| XLogP | 2.87 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|