C16H18F3N5O — CID 147808602
4-N-tert-butyl-5-[4-(trifluoromethoxy)benzenecarboximidoyl]pyrimidine-4,6-diamine (PubChem CID 147808602) has the molecular formula C16H18F3N5O and a molecular weight of 353.35 g/mol. Its IUPAC name is 4-N-tert-butyl-5-[4-(trifluoromethoxy)benzenecarboximidoyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-tert-butyl-5-[4-(trifluoromethoxy)benzenecarboximidoyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 147808602 |
| Molecular Formula | C16H18F3N5O |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 4-N-tert-butyl-5-[4-(trifluoromethoxy)benzenecarboximidoyl]pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc(OC(F)(F)F)cc1)c1c(N)ncnc1NC(C)(C)C |
| InChI | InChI=1S/C16H18F3N5O/c1-15(2,3)24-14-11(13(21)22-8-23-14)12(20)9-4-6-10(7-5-9)25-16(17,18)19/h4-8,20H,1-3H3,(H3,21,22,23,24)/b20-12+ |
| InChIKey | HMXMJDVBNDKDBV-UDWIEESQSA-N |
| XLogP | 3.58 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|