C19H21ClN6O2 — CID 167082486
methyl 2-[4-amino-6-(tert-butylamino)pyrimidine-5-carboximidoyl]-3-chloro-1H-indole-6-carboxylate (PubChem CID 167082486) has the molecular formula C19H21ClN6O2 and a molecular weight of 400.87 g/mol. Its IUPAC name is methyl 2-[4-amino-6-(tert-butylamino)pyrimidine-5-carboximidoyl]-3-chloro-1H-indole-6-carboxylate.
| Compound Name | methyl 2-[4-amino-6-(tert-butylamino)pyrimidine-5-carboximidoyl]-3-chloro-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 167082486 |
| Molecular Formula | C19H21ClN6O2 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | methyl 2-[4-amino-6-(tert-butylamino)pyrimidine-5-carboximidoyl]-3-chloro-1H-indole-6-carboxylate |
| SMILES | [H]/N=C(\c1[nH]c2cc(C(=O)OC)ccc2c1Cl)c1c(N)ncnc1NC(C)(C)C |
| InChI | InChI=1S/C19H21ClN6O2/c1-19(2,3)26-17-12(16(22)23-8-24-17)14(21)15-13(20)10-6-5-9(18(27)28-4)7-11(10)25-15/h5-8,21,25H,1-4H3,(H3,22,23,24,26)/b21-14- |
| InChIKey | XLMSLOBPQFNXFT-STZFKDTASA-N |
| XLogP | 3.61 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|