C17H21N5O2 — CID 71714938
methyl 4-[3-(dimethylamino)propylamino]-9H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 71714938) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is methyl 4-[3-(dimethylamino)propylamino]-9H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 4-[3-(dimethylamino)propylamino]-9H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 71714938 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | methyl 4-[3-(dimethylamino)propylamino]-9H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[nH]c1ncnc(NCCCN(C)C)c12 |
| InChI | InChI=1S/C17H21N5O2/c1-22(2)8-4-7-18-15-14-12-6-5-11(17(23)24-3)9-13(12)21-16(14)20-10-19-15/h5-6,9-10H,4,7-8H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | HWGUBGYYDJWZSU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|