C20H28N6O2 — CID 156516567
methyl 4-[3-[3-aminopropyl(methyl)amino]propylamino]-2-methyl-9H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 156516567) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is methyl 4-[3-[3-aminopropyl(methyl)amino]propylamino]-2-methyl-9H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 4-[3-[3-aminopropyl(methyl)amino]propylamino]-2-methyl-9H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 156516567 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | methyl 4-[3-[3-aminopropyl(methyl)amino]propylamino]-2-methyl-9H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[nH]c1nc(C)nc(NCCCN(C)CCCN)c12 |
| InChI | InChI=1S/C20H28N6O2/c1-13-23-18(22-9-5-11-26(2)10-4-8-21)17-15-7-6-14(20(27)28-3)12-16(15)25-19(17)24-13/h6-7,12H,4-5,8-11,21H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | QCPYURCLICXXLH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|