C25H33N5O2 — CID 138630881
methyl 4-[(4-amino-4-methylpentyl)amino]-2-[(Z,2Z)-2-ethylidenepent-3-enyl]-9H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 138630881) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is methyl 4-[(4-amino-4-methylpentyl)amino]-2-[(Z,2Z)-2-ethylidenepent-3-enyl]-9H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 4-[(4-amino-4-methylpentyl)amino]-2-[(Z,2Z)-2-ethylidenepent-3-enyl]-9H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 138630881 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | methyl 4-[(4-amino-4-methylpentyl)amino]-2-[(Z,2Z)-2-ethylidenepent-3-enyl]-9H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | C/C=C\C(=C/C)Cc1nc(NCCCC(C)(C)N)c2c(n1)[nH]c1cc(C(=O)OC)ccc12 |
| InChI | InChI=1S/C25H33N5O2/c1-6-9-16(7-2)14-20-29-22(27-13-8-12-25(3,4)26)21-18-11-10-17(24(31)32-5)15-19(18)28-23(21)30-20/h6-7,9-11,15H,8,12-14,26H2,1-5H3,(H2,27,28,29,30)/b9-6-,16-7+ |
| InChIKey | QHPAVDXODYECQV-ATPUMGGESA-N |
| XLogP | 4.89 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|