C30H34F3N5O3 — CID 130411934
methyl 4-(3-piperidin-1-ylpropylamino)-2-[(3Z,5E)-8,8,8-trifluoro-6-methyl-2-methylidene-7-oxoocta-3,5-dienyl]-9H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 130411934) has the molecular formula C30H34F3N5O3 and a molecular weight of 569.63 g/mol. Its IUPAC name is methyl 4-(3-piperidin-1-ylpropylamino)-2-[(3Z,5E)-8,8,8-trifluoro-6-methyl-2-methylidene-7-oxoocta-3,5-dienyl]-9H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 4-(3-piperidin-1-ylpropylamino)-2-[(3Z,5E)-8,8,8-trifluoro-6-methyl-2-methylidene-7-oxoocta-3,5-dienyl]-9H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 130411934 |
| Molecular Formula | C30H34F3N5O3 |
| Molecular Weight | 569.63 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | methyl 4-(3-piperidin-1-ylpropylamino)-2-[(3Z,5E)-8,8,8-trifluoro-6-methyl-2-methylidene-7-oxoocta-3,5-dienyl]-9H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | C=C(/C=C\C=C(/C)C(=O)C(F)(F)F)Cc1nc(NCCCN2CCCCC2)c2c(n1)[nH]c1cc(C(=O)OC)ccc12 |
| InChI | InChI=1S/C30H34F3N5O3/c1-19(9-7-10-20(2)26(39)30(31,32)33)17-24-36-27(34-13-8-16-38-14-5-4-6-15-38)25-22-12-11-21(29(40)41-3)18-23(22)35-28(25)37-24/h7,9-12,18H,1,4-6,8,13-17H2,2-3H3,(H2,34,35,36,37)/b9-7-,20-10+ |
| InChIKey | IXMSHGDRXVRLEF-CYSYATMXSA-N |
| XLogP | 5.92 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|