C28H34N6O2 — CID 118972658
methyl 4-[amino(3-piperidin-1-ylpropyl)amino]-2-[(2-methylphenyl)methyl]-9H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 118972658) has the molecular formula C28H34N6O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is methyl 4-[amino(3-piperidin-1-ylpropyl)amino]-2-[(2-methylphenyl)methyl]-9H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 4-[amino(3-piperidin-1-ylpropyl)amino]-2-[(2-methylphenyl)methyl]-9H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 118972658 |
| Molecular Formula | C28H34N6O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | methyl 4-[amino(3-piperidin-1-ylpropyl)amino]-2-[(2-methylphenyl)methyl]-9H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[nH]c1nc(Cc3ccccc3C)nc(N(N)CCCN3CCCCC3)c12 |
| InChI | InChI=1S/C28H34N6O2/c1-19-9-4-5-10-20(19)18-24-31-26-25(22-12-11-21(28(35)36-2)17-23(22)30-26)27(32-24)34(29)16-8-15-33-13-6-3-7-14-33/h4-5,9-12,17H,3,6-8,13-16,18,29H2,1-2H3,(H,30,31,32) |
| InChIKey | UXNJSRCBCGPOLT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|