C26H31N5O2 — CID 130411893
methyl 2-benzyl-4-[[4-methyl-4-(methylamino)pentyl]amino]-9H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 130411893) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is methyl 2-benzyl-4-[[4-methyl-4-(methylamino)pentyl]amino]-9H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 2-benzyl-4-[[4-methyl-4-(methylamino)pentyl]amino]-9H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 130411893 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | methyl 2-benzyl-4-[[4-methyl-4-(methylamino)pentyl]amino]-9H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | CNC(C)(C)CCCNc1nc(Cc2ccccc2)nc2[nH]c3cc(C(=O)OC)ccc3c12 |
| InChI | InChI=1S/C26H31N5O2/c1-26(2,27-3)13-8-14-28-23-22-19-12-11-18(25(32)33-4)16-20(19)29-24(22)31-21(30-23)15-17-9-6-5-7-10-17/h5-7,9-12,16,27H,8,13-15H2,1-4H3,(H2,28,29,30,31) |
| InChIKey | KMHPUOCDSXSQIU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|