C27H32N6 — CID 144949156
3-benzyl-1-(3-piperidin-1-ylpropylamino)-5H-pyrido[4,3-b]indole-7-carboximidamide (PubChem CID 144949156) has the molecular formula C27H32N6 and a molecular weight of 440.60 g/mol. Its IUPAC name is 3-benzyl-1-(3-piperidin-1-ylpropylamino)-5H-pyrido[4,3-b]indole-7-carboximidamide.
| Compound Name | 3-benzyl-1-(3-piperidin-1-ylpropylamino)-5H-pyrido[4,3-b]indole-7-carboximidamide |
|---|---|
| PubChem CID | 144949156 |
| Molecular Formula | C27H32N6 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 3-benzyl-1-(3-piperidin-1-ylpropylamino)-5H-pyrido[4,3-b]indole-7-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)[nH]c1cc(Cc3ccccc3)nc(NCCCN3CCCCC3)c12 |
| InChI | InChI=1S/C27H32N6/c28-26(29)20-10-11-22-23(17-20)32-24-18-21(16-19-8-3-1-4-9-19)31-27(25(22)24)30-12-7-15-33-13-5-2-6-14-33/h1,3-4,8-11,17-18,32H,2,5-7,12-16H2,(H3,28,29)(H,30,31) |
| InChIKey | UXXYAMVXPLZQOJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|