C29H33N3O2 — CID 158220237
3-benzyl-7-methyl-N-(3-piperidin-1-ylpropyl)-5H-indeno[1,2-c]pyridin-1-amine;carbon dioxide (PubChem CID 158220237) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is 3-benzyl-7-methyl-N-(3-piperidin-1-ylpropyl)-5H-indeno[1,2-c]pyridin-1-amine;carbon dioxide.
| Compound Name | 3-benzyl-7-methyl-N-(3-piperidin-1-ylpropyl)-5H-indeno[1,2-c]pyridin-1-amine;carbon dioxide |
|---|---|
| PubChem CID | 158220237 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 3-benzyl-7-methyl-N-(3-piperidin-1-ylpropyl)-5H-indeno[1,2-c]pyridin-1-amine;carbon dioxide |
| SMILES | Cc1ccc2c(c1)Cc1cc(Cc3ccccc3)nc(NCCCN3CCCCC3)c1-2.O=C=O |
| InChI | InChI=1S/C28H33N3.CO2/c1-21-11-12-26-23(17-21)19-24-20-25(18-22-9-4-2-5-10-22)30-28(27(24)26)29-13-8-16-31-14-6-3-7-15-31;2-1-3/h2,4-5,9-12,17,20H,3,6-8,13-16,18-19H2,1H3,(H,29,30); |
| InChIKey | GDDOZIHDSHROPH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|