C27H31BrN4 — CID 160802541
2-[(3-bromophenyl)methyl]-7-methyl-N-(3-piperidin-1-ylpropyl)-9H-indeno[2,1-d]pyrimidin-4-amine (PubChem CID 160802541) has the molecular formula C27H31BrN4 and a molecular weight of 491.48 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-7-methyl-N-(3-piperidin-1-ylpropyl)-9H-indeno[2,1-d]pyrimidin-4-amine.
| Compound Name | 2-[(3-bromophenyl)methyl]-7-methyl-N-(3-piperidin-1-ylpropyl)-9H-indeno[2,1-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 160802541 |
| Molecular Formula | C27H31BrN4 |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-7-methyl-N-(3-piperidin-1-ylpropyl)-9H-indeno[2,1-d]pyrimidin-4-amine |
| SMILES | Cc1ccc2c(c1)Cc1nc(Cc3cccc(Br)c3)nc(NCCCN3CCCCC3)c1-2 |
| InChI | InChI=1S/C27H31BrN4/c1-19-9-10-23-21(15-19)18-24-26(23)27(29-11-6-14-32-12-3-2-4-13-32)31-25(30-24)17-20-7-5-8-22(28)16-20/h5,7-10,15-16H,2-4,6,11-14,17-18H2,1H3,(H,29,30,31) |
| InChIKey | XCDSVDIZPXWYPP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|