C28H35N5O2 — CID 138630945
methyl 2-[(4-methylphenyl)methyl]-4-(3-piperidin-1-ylpropylamino)-7,9-dihydro-6H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 138630945) has the molecular formula C28H35N5O2 and a molecular weight of 473.62 g/mol. Its IUPAC name is methyl 2-[(4-methylphenyl)methyl]-4-(3-piperidin-1-ylpropylamino)-7,9-dihydro-6H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 2-[(4-methylphenyl)methyl]-4-(3-piperidin-1-ylpropylamino)-7,9-dihydro-6H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 138630945 |
| Molecular Formula | C28H35N5O2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | methyl 2-[(4-methylphenyl)methyl]-4-(3-piperidin-1-ylpropylamino)-7,9-dihydro-6H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | COC(=O)C1C=c2[nH]c3nc(Cc4ccc(C)cc4)nc(NCCCN4CCCCC4)c3c2=CC1 |
| InChI | InChI=1S/C28H35N5O2/c1-19-7-9-20(10-8-19)17-24-31-26(29-13-6-16-33-14-4-3-5-15-33)25-22-12-11-21(28(34)35-2)18-23(22)30-27(25)32-24/h7-10,12,18,21H,3-6,11,13-17H2,1-2H3,(H2,29,30,31,32) |
| InChIKey | XRGNCDDFMABXDB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|