C26H31N5 — CID 160556515
11-benzyl-5-methyl-N-(3-piperidin-1-ylpropyl)-3,10,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-13-amine (PubChem CID 160556515) has the molecular formula C26H31N5 and a molecular weight of 413.57 g/mol. Its IUPAC name is 11-benzyl-5-methyl-N-(3-piperidin-1-ylpropyl)-3,10,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-13-amine.
| Compound Name | 11-benzyl-5-methyl-N-(3-piperidin-1-ylpropyl)-3,10,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-13-amine |
|---|---|
| PubChem CID | 160556515 |
| Molecular Formula | C26H31N5 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 11-benzyl-5-methyl-N-(3-piperidin-1-ylpropyl)-3,10,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-13-amine |
| SMILES | Cc1cnc2c(c1)Cc1nc(Cc3ccccc3)nc(NCCCN3CCCCC3)c1-2 |
| InChI | InChI=1S/C26H31N5/c1-19-15-21-17-22-24(25(21)28-18-19)26(27-11-8-14-31-12-6-3-7-13-31)30-23(29-22)16-20-9-4-2-5-10-20/h2,4-5,9-10,15,18H,3,6-8,11-14,16-17H2,1H3,(H,27,29,30) |
| InChIKey | ZWAARPWJMYVVQN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|