C24H28N4S2 — CID 158697291
5-methyl-13-(3-piperidin-1-ylpropylsulfanyl)-11-(thiophen-3-ylmethyl)-3,10,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 158697291) has the molecular formula C24H28N4S2 and a molecular weight of 436.65 g/mol. Its IUPAC name is 5-methyl-13-(3-piperidin-1-ylpropylsulfanyl)-11-(thiophen-3-ylmethyl)-3,10,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-methyl-13-(3-piperidin-1-ylpropylsulfanyl)-11-(thiophen-3-ylmethyl)-3,10,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 158697291 |
| Molecular Formula | C24H28N4S2 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 5-methyl-13-(3-piperidin-1-ylpropylsulfanyl)-11-(thiophen-3-ylmethyl)-3,10,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1cnc2c(c1)Cc1nc(Cc3ccsc3)nc(SCCCN3CCCCC3)c1-2 |
| InChI | InChI=1S/C24H28N4S2/c1-17-12-19-14-20-22(23(19)25-15-17)24(27-21(26-20)13-18-6-11-29-16-18)30-10-5-9-28-7-3-2-4-8-28/h6,11-12,15-16H,2-5,7-10,13-14H2,1H3 |
| InChIKey | ZNSALUJKTGIJEE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|