C28H36N4 — CID 157288816
7-methyl-2-[(3-methylphenyl)methyl]-N-(3-piperidin-1-ylpropyl)-7,9-dihydro-6H-indeno[2,1-d]pyrimidin-4-amine (PubChem CID 157288816) has the molecular formula C28H36N4 and a molecular weight of 428.62 g/mol. Its IUPAC name is 7-methyl-2-[(3-methylphenyl)methyl]-N-(3-piperidin-1-ylpropyl)-7,9-dihydro-6H-indeno[2,1-d]pyrimidin-4-amine.
| Compound Name | 7-methyl-2-[(3-methylphenyl)methyl]-N-(3-piperidin-1-ylpropyl)-7,9-dihydro-6H-indeno[2,1-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 157288816 |
| Molecular Formula | C28H36N4 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 7-methyl-2-[(3-methylphenyl)methyl]-N-(3-piperidin-1-ylpropyl)-7,9-dihydro-6H-indeno[2,1-d]pyrimidin-4-amine |
| SMILES | Cc1cccc(Cc2nc3c(c(NCCCN4CCCCC4)n2)C2=CCC(C)C=C2C3)c1 |
| InChI | InChI=1S/C28H36N4/c1-20-8-6-9-22(16-20)18-26-30-25-19-23-17-21(2)10-11-24(23)27(25)28(31-26)29-12-7-15-32-13-4-3-5-14-32/h6,8-9,11,16-17,21H,3-5,7,10,12-15,18-19H2,1-2H3,(H,29,30,31) |
| InChIKey | BAOAOVMNPXZEEY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|