C27H31N5O — CID 149273487
1-[4-(3-piperidin-1-ylpropylamino)-2-(pyridin-4-ylmethyl)-9H-indeno[2,1-d]pyrimidin-7-yl]ethanone (PubChem CID 149273487) has the molecular formula C27H31N5O and a molecular weight of 441.58 g/mol. Its IUPAC name is 1-[4-(3-piperidin-1-ylpropylamino)-2-(pyridin-4-ylmethyl)-9H-indeno[2,1-d]pyrimidin-7-yl]ethanone.
| Compound Name | 1-[4-(3-piperidin-1-ylpropylamino)-2-(pyridin-4-ylmethyl)-9H-indeno[2,1-d]pyrimidin-7-yl]ethanone |
|---|---|
| PubChem CID | 149273487 |
| Molecular Formula | C27H31N5O |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 1-[4-(3-piperidin-1-ylpropylamino)-2-(pyridin-4-ylmethyl)-9H-indeno[2,1-d]pyrimidin-7-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)Cc1nc(Cc3ccncc3)nc(NCCCN3CCCCC3)c1-2 |
| InChI | InChI=1S/C27H31N5O/c1-19(33)21-6-7-23-22(17-21)18-24-26(23)27(29-10-5-15-32-13-3-2-4-14-32)31-25(30-24)16-20-8-11-28-12-9-20/h6-9,11-12,17H,2-5,10,13-16,18H2,1H3,(H,29,30,31) |
| InChIKey | XRNOSHFXOZRMQO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|