C29H34N4O — CID 148526543
1-[2-(1-phenylethyl)-4-(3-piperidin-1-ylpropylamino)-9H-indeno[2,1-d]pyrimidin-7-yl]ethanone (PubChem CID 148526543) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is 1-[2-(1-phenylethyl)-4-(3-piperidin-1-ylpropylamino)-9H-indeno[2,1-d]pyrimidin-7-yl]ethanone.
| Compound Name | 1-[2-(1-phenylethyl)-4-(3-piperidin-1-ylpropylamino)-9H-indeno[2,1-d]pyrimidin-7-yl]ethanone |
|---|---|
| PubChem CID | 148526543 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1-[2-(1-phenylethyl)-4-(3-piperidin-1-ylpropylamino)-9H-indeno[2,1-d]pyrimidin-7-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)Cc1nc(C(C)c3ccccc3)nc(NCCCN3CCCCC3)c1-2 |
| InChI | InChI=1S/C29H34N4O/c1-20(22-10-5-3-6-11-22)28-31-26-19-24-18-23(21(2)34)12-13-25(24)27(26)29(32-28)30-14-9-17-33-15-7-4-8-16-33/h3,5-6,10-13,18,20H,4,7-9,14-17,19H2,1-2H3,(H,30,31,32) |
| InChIKey | MPLKPEMJZIFOKD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|