C33H38N4O2 — CID 158695776
1-[3-[(2-benzyl-7-methyl-9H-indeno[2,1-d]pyrimidin-4-yl)amino]propyl-methylamino]-3-phenylmethoxypropan-2-ol (PubChem CID 158695776) has the molecular formula C33H38N4O2 and a molecular weight of 522.69 g/mol. Its IUPAC name is 1-[3-[(2-benzyl-7-methyl-9H-indeno[2,1-d]pyrimidin-4-yl)amino]propyl-methylamino]-3-phenylmethoxypropan-2-ol.
| Compound Name | 1-[3-[(2-benzyl-7-methyl-9H-indeno[2,1-d]pyrimidin-4-yl)amino]propyl-methylamino]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 158695776 |
| Molecular Formula | C33H38N4O2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 1-[3-[(2-benzyl-7-methyl-9H-indeno[2,1-d]pyrimidin-4-yl)amino]propyl-methylamino]-3-phenylmethoxypropan-2-ol |
| SMILES | Cc1ccc2c(c1)Cc1nc(Cc3ccccc3)nc(NCCCN(C)CC(O)COCc3ccccc3)c1-2 |
| InChI | InChI=1S/C33H38N4O2/c1-24-14-15-29-27(18-24)20-30-32(29)33(36-31(35-30)19-25-10-5-3-6-11-25)34-16-9-17-37(2)21-28(38)23-39-22-26-12-7-4-8-13-26/h3-8,10-15,18,28,38H,9,16-17,19-23H2,1-2H3,(H,34,35,36) |
| InChIKey | TWKZDDCSAKVDGZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|