C14H24N4 — CID 82057653
5-methyl-2-N-(4-pyrrolidin-1-ylbutyl)pyridine-2,3-diamine (PubChem CID 82057653) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 5-methyl-2-N-(4-pyrrolidin-1-ylbutyl)pyridine-2,3-diamine.
| Compound Name | 5-methyl-2-N-(4-pyrrolidin-1-ylbutyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 82057653 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 5-methyl-2-N-(4-pyrrolidin-1-ylbutyl)pyridine-2,3-diamine |
| SMILES | Cc1cnc(NCCCCN2CCCC2)c(N)c1 |
| InChI | InChI=1S/C14H24N4/c1-12-10-13(15)14(17-11-12)16-6-2-3-7-18-8-4-5-9-18/h10-11H,2-9,15H2,1H3,(H,16,17) |
| InChIKey | OBFNWKLLXTZMNN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|