C9H14N4O2 — CID 83202225
2-[(3-amino-5-methyl-2-pyridinyl)amino]ethyl carbamate (PubChem CID 83202225) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-[(3-amino-5-methyl-2-pyridinyl)amino]ethyl carbamate.
| Compound Name | 2-[(3-amino-5-methyl-2-pyridinyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83202225 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-[(3-amino-5-methyl-2-pyridinyl)amino]ethyl carbamate |
| SMILES | Cc1cnc(NCCOC(N)=O)c(N)c1 |
| InChI | InChI=1S/C9H14N4O2/c1-6-4-7(10)8(13-5-6)12-2-3-15-9(11)14/h4-5H,2-3,10H2,1H3,(H2,11,14)(H,12,13) |
| InChIKey | XYDJYZHGIALCSA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|