C19H23N5O — CID 145041709
1-[4-(2-piperidin-4-ylethylamino)-9H-pyrimido[4,5-b]indol-7-yl]ethanone (PubChem CID 145041709) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 1-[4-(2-piperidin-4-ylethylamino)-9H-pyrimido[4,5-b]indol-7-yl]ethanone.
| Compound Name | 1-[4-(2-piperidin-4-ylethylamino)-9H-pyrimido[4,5-b]indol-7-yl]ethanone |
|---|---|
| PubChem CID | 145041709 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 1-[4-(2-piperidin-4-ylethylamino)-9H-pyrimido[4,5-b]indol-7-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)[nH]c1ncnc(NCCC3CCNCC3)c12 |
| InChI | InChI=1S/C19H23N5O/c1-12(25)14-2-3-15-16(10-14)24-19-17(15)18(22-11-23-19)21-9-6-13-4-7-20-8-5-13/h2-3,10-11,13,20H,4-9H2,1H3,(H2,21,22,23,24) |
| InChIKey | RDABFNBTJCPGOR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |