C22H25N5O2 — CID 66552583
1-(6-benzoyl-1H-benzimidazol-2-yl)-3-(2-piperidin-4-ylethyl)urea (PubChem CID 66552583) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 1-(6-benzoyl-1H-benzimidazol-2-yl)-3-(2-piperidin-4-ylethyl)urea.
| Compound Name | 1-(6-benzoyl-1H-benzimidazol-2-yl)-3-(2-piperidin-4-ylethyl)urea |
|---|---|
| PubChem CID | 66552583 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 1-(6-benzoyl-1H-benzimidazol-2-yl)-3-(2-piperidin-4-ylethyl)urea |
| SMILES | O=C(NCCC1CCNCC1)Nc1nc2ccc(C(=O)c3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C22H25N5O2/c28-20(16-4-2-1-3-5-16)17-6-7-18-19(14-17)26-21(25-18)27-22(29)24-13-10-15-8-11-23-12-9-15/h1-7,14-15,23H,8-13H2,(H3,24,25,26,27,29) |
| InChIKey | RMKJKBCWXWSHSS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |