C12H14N4O3 — CID 82563089
2-(2-acetamidoethylamino)-3H-benzimidazole-5-carboxylic acid (PubChem CID 82563089) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-(2-acetamidoethylamino)-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-(2-acetamidoethylamino)-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82563089 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-(2-acetamidoethylamino)-3H-benzimidazole-5-carboxylic acid |
| SMILES | CC(=O)NCCNc1nc2ccc(C(=O)O)cc2[nH]1 |
| InChI | InChI=1S/C12H14N4O3/c1-7(17)13-4-5-14-12-15-9-3-2-8(11(18)19)6-10(9)16-12/h2-3,6H,4-5H2,1H3,(H,13,17)(H,18,19)(H2,14,15,16) |
| InChIKey | VPKAJCFGPCNJGW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|