C21H22Cl2N4O4S2 — CID 87123372
[2-(2-piperidin-4-ylethylcarbamoylamino)-1,3-benzothiazol-6-yl] 2,6-dichlorobenzenesulfonate (PubChem CID 87123372) has the molecular formula C21H22Cl2N4O4S2 and a molecular weight of 529.47 g/mol. Its IUPAC name is [2-(2-piperidin-4-ylethylcarbamoylamino)-1,3-benzothiazol-6-yl] 2,6-dichlorobenzenesulfonate.
| Compound Name | [2-(2-piperidin-4-ylethylcarbamoylamino)-1,3-benzothiazol-6-yl] 2,6-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 87123372 |
| Molecular Formula | C21H22Cl2N4O4S2 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | [2-(2-piperidin-4-ylethylcarbamoylamino)-1,3-benzothiazol-6-yl] 2,6-dichlorobenzenesulfonate |
| SMILES | O=C(NCCC1CCNCC1)Nc1nc2ccc(OS(=O)(=O)c3c(Cl)cccc3Cl)cc2s1 |
| InChI | InChI=1S/C21H22Cl2N4O4S2/c22-15-2-1-3-16(23)19(15)33(29,30)31-14-4-5-17-18(12-14)32-21(26-17)27-20(28)25-11-8-13-6-9-24-10-7-13/h1-5,12-13,24H,6-11H2,(H2,25,26,27,28) |
| InChIKey | LCZWNMXPQFSIFA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|