C25H33N5O4S2 — CID 11541433
[2-(3-piperidin-4-ylpropanoylamino)-1,3-benzothiazol-6-yl] 4-[2-(ethylamino)ethylamino]benzenesulfonate (PubChem CID 11541433) has the molecular formula C25H33N5O4S2 and a molecular weight of 531.70 g/mol. Its IUPAC name is [2-(3-piperidin-4-ylpropanoylamino)-1,3-benzothiazol-6-yl] 4-[2-(ethylamino)ethylamino]benzenesulfonate.
| Compound Name | [2-(3-piperidin-4-ylpropanoylamino)-1,3-benzothiazol-6-yl] 4-[2-(ethylamino)ethylamino]benzenesulfonate |
|---|---|
| PubChem CID | 11541433 |
| Molecular Formula | C25H33N5O4S2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | [2-(3-piperidin-4-ylpropanoylamino)-1,3-benzothiazol-6-yl] 4-[2-(ethylamino)ethylamino]benzenesulfonate |
| SMILES | CCNCCNc1ccc(S(=O)(=O)Oc2ccc3nc(NC(=O)CCC4CCNCC4)sc3c2)cc1 |
| InChI | InChI=1S/C25H33N5O4S2/c1-2-26-15-16-28-19-4-7-21(8-5-19)36(32,33)34-20-6-9-22-23(17-20)35-25(29-22)30-24(31)10-3-18-11-13-27-14-12-18/h4-9,17-18,26-28H,2-3,10-16H2,1H3,(H,29,30,31) |
| InChIKey | GCHKKMSJHMPVQF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|