C21H16Cl2N4O4S — CID 87123396
[2-(benzylcarbamoylamino)-3H-benzimidazol-5-yl] 2,6-dichlorobenzenesulfonate (PubChem CID 87123396) has the molecular formula C21H16Cl2N4O4S and a molecular weight of 491.36 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-3H-benzimidazol-5-yl] 2,6-dichlorobenzenesulfonate.
| Compound Name | [2-(benzylcarbamoylamino)-3H-benzimidazol-5-yl] 2,6-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 87123396 |
| Molecular Formula | C21H16Cl2N4O4S |
| Molecular Weight | 491.36 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | [2-(benzylcarbamoylamino)-3H-benzimidazol-5-yl] 2,6-dichlorobenzenesulfonate |
| SMILES | O=C(NCc1ccccc1)Nc1nc2ccc(OS(=O)(=O)c3c(Cl)cccc3Cl)cc2[nH]1 |
| InChI | InChI=1S/C21H16Cl2N4O4S/c22-15-7-4-8-16(23)19(15)32(29,30)31-14-9-10-17-18(11-14)26-20(25-17)27-21(28)24-12-13-5-2-1-3-6-13/h1-11H,12H2,(H3,24,25,26,27,28) |
| InChIKey | ZLQPKWBZIIGJNY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|