C25H27N5O6S — CID 87768684
[2-(3-hydroxypropylcarbamoylamino)-3H-benzimidazol-5-yl] 4-[(4-methoxyphenyl)methylamino]benzenesulfonate (PubChem CID 87768684) has the molecular formula C25H27N5O6S and a molecular weight of 525.59 g/mol. Its IUPAC name is [2-(3-hydroxypropylcarbamoylamino)-3H-benzimidazol-5-yl] 4-[(4-methoxyphenyl)methylamino]benzenesulfonate.
| Compound Name | [2-(3-hydroxypropylcarbamoylamino)-3H-benzimidazol-5-yl] 4-[(4-methoxyphenyl)methylamino]benzenesulfonate |
|---|---|
| PubChem CID | 87768684 |
| Molecular Formula | C25H27N5O6S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | [2-(3-hydroxypropylcarbamoylamino)-3H-benzimidazol-5-yl] 4-[(4-methoxyphenyl)methylamino]benzenesulfonate |
| SMILES | COc1ccc(CNc2ccc(S(=O)(=O)Oc3ccc4nc(NC(=O)NCCCO)[nH]c4c3)cc2)cc1 |
| InChI | InChI=1S/C25H27N5O6S/c1-35-19-7-3-17(4-8-19)16-27-18-5-10-21(11-6-18)37(33,34)36-20-9-12-22-23(15-20)29-24(28-22)30-25(32)26-13-2-14-31/h3-12,15,27,31H,2,13-14,16H2,1H3,(H3,26,28,29,30,32) |
| InChIKey | VQDWVPDPOKTASA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 154.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|