C22H27N5O5S — CID 12018371
[2-(2-methoxyethylcarbamoylamino)-3H-benzimidazol-5-yl] 4-(cyclopentylamino)benzenesulfonate (PubChem CID 12018371) has the molecular formula C22H27N5O5S and a molecular weight of 473.56 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-3H-benzimidazol-5-yl] 4-(cyclopentylamino)benzenesulfonate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-3H-benzimidazol-5-yl] 4-(cyclopentylamino)benzenesulfonate |
|---|---|
| PubChem CID | 12018371 |
| Molecular Formula | C22H27N5O5S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-3H-benzimidazol-5-yl] 4-(cyclopentylamino)benzenesulfonate |
| SMILES | COCCNC(=O)Nc1nc2ccc(OS(=O)(=O)c3ccc(NC4CCCC4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C22H27N5O5S/c1-31-13-12-23-22(28)27-21-25-19-11-8-17(14-20(19)26-21)32-33(29,30)18-9-6-16(7-10-18)24-15-4-2-3-5-15/h6-11,14-15,24H,2-5,12-13H2,1H3,(H3,23,25,26,27,28) |
| InChIKey | ZBAUMXGXRPGZCU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 134.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|