C22H27N5O6S — CID 22147000
[2-(2-methoxyethylcarbamoylamino)-3H-benzimidazol-5-yl] 4-(4-hydroxypiperidin-1-yl)benzenesulfonate (PubChem CID 22147000) has the molecular formula C22H27N5O6S and a molecular weight of 489.55 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-3H-benzimidazol-5-yl] 4-(4-hydroxypiperidin-1-yl)benzenesulfonate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-3H-benzimidazol-5-yl] 4-(4-hydroxypiperidin-1-yl)benzenesulfonate |
|---|---|
| PubChem CID | 22147000 |
| Molecular Formula | C22H27N5O6S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-3H-benzimidazol-5-yl] 4-(4-hydroxypiperidin-1-yl)benzenesulfonate |
| SMILES | COCCNC(=O)Nc1nc2ccc(OS(=O)(=O)c3ccc(N4CCC(O)CC4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C22H27N5O6S/c1-32-13-10-23-22(29)26-21-24-19-7-4-17(14-20(19)25-21)33-34(30,31)18-5-2-15(3-6-18)27-11-8-16(28)9-12-27/h2-7,14,16,28H,8-13H2,1H3,(H3,23,24,25,26,29) |
| InChIKey | SFFKGXOFOHDRHO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 145.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|