C23H24N6O4S — CID 87767728
[2-(cyclohexylcarbamoylamino)-3H-benzimidazol-5-yl] 4-imidazol-1-ylbenzenesulfonate (PubChem CID 87767728) has the molecular formula C23H24N6O4S and a molecular weight of 480.55 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-3H-benzimidazol-5-yl] 4-imidazol-1-ylbenzenesulfonate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-3H-benzimidazol-5-yl] 4-imidazol-1-ylbenzenesulfonate |
|---|---|
| PubChem CID | 87767728 |
| Molecular Formula | C23H24N6O4S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-3H-benzimidazol-5-yl] 4-imidazol-1-ylbenzenesulfonate |
| SMILES | O=C(Nc1nc2ccc(OS(=O)(=O)c3ccc(-n4ccnc4)cc3)cc2[nH]1)NC1CCCCC1 |
| InChI | InChI=1S/C23H24N6O4S/c30-23(25-16-4-2-1-3-5-16)28-22-26-20-11-8-18(14-21(20)27-22)33-34(31,32)19-9-6-17(7-10-19)29-13-12-24-15-29/h6-16H,1-5H2,(H3,25,26,27,28,30) |
| InChIKey | YUZLMGPKRSRJPV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|