About [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate
[2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate (PubChem CID 87767692) has the molecular formula C20H22N4O6S
and a molecular weight of 446.49 g/mol. Its IUPAC name is [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate.
Molecular Properties
| Compound Name | [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate |
| PubChem CID | 87767692 |
| Molecular Formula | C20H22N4O6S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate |
| SMILES | O=C(Nc1nc2ccc(OS(=O)(=O)c3ccc(NCC(O)CO)cc3)cc2[nH]1)C1CC1 |
| InChI | InChI=1S/C20H22N4O6S/c25-11-14(26)10-21-13-3-6-16(7-4-13)31(28,29)30-15-5-8-17-18(9-15)23-20(22-17)24-19(27)12-1-2-12/h3-9,12,14,21,25-26H,1-2,10-11H2,(H2,22,23,24,27) |
| InChIKey | ORXUVRROFKBJNU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 153.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate?
The IUPAC name of [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate (CID 87767692) is [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate.
What is the SMILES notation for [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate?
The canonical SMILES for [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate is O=C(Nc1nc2ccc(OS(=O)(=O)c3ccc(NCC(O)CO)cc3)cc2[nH]1)C1CC1.
What is the InChIKey of [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate?
The InChIKey is ORXUVRROFKBJNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O6S/c25-11-14(26)10-21-13-3-6-16(7-4-13)31(28,29)30-15-5-8-17-18(9-15)23-20(22-17)24-19(27)12-1-2-12/h3-9,12,14,21,25-26H,1-2,10-11H2,(H2,22,23,24,27).
What are the key properties of [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate?
[2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate has a molecular weight of 446.49 g/mol, XLogP of 1.44, 9 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-(2,3-dihydroxypropylamino)benzenesulfonate is sourced from PubChem (CID 87767692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).