C21H24N4O5S — CID 87767605
[2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-[ethyl(2-hydroxyethyl)amino]benzenesulfonate (PubChem CID 87767605) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-[ethyl(2-hydroxyethyl)amino]benzenesulfonate.
| Compound Name | [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-[ethyl(2-hydroxyethyl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 87767605 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [2-(cyclopropanecarbonylamino)-3H-benzimidazol-5-yl] 4-[ethyl(2-hydroxyethyl)amino]benzenesulfonate |
| SMILES | CCN(CCO)c1ccc(S(=O)(=O)Oc2ccc3nc(NC(=O)C4CC4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C21H24N4O5S/c1-2-25(11-12-26)15-5-8-17(9-6-15)31(28,29)30-16-7-10-18-19(13-16)23-21(22-18)24-20(27)14-3-4-14/h5-10,13-14,26H,2-4,11-12H2,1H3,(H2,22,23,24,27) |
| InChIKey | LTYYWVKVQOGCKI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|