C27H28Cl2N6O4S — CID 87123409
[2-[2-(4-benzylpiperazin-1-yl)ethylcarbamoylamino]-3H-benzimidazol-5-yl] 2,6-dichlorobenzenesulfonate (PubChem CID 87123409) has the molecular formula C27H28Cl2N6O4S and a molecular weight of 603.53 g/mol. Its IUPAC name is [2-[2-(4-benzylpiperazin-1-yl)ethylcarbamoylamino]-3H-benzimidazol-5-yl] 2,6-dichlorobenzenesulfonate.
| Compound Name | [2-[2-(4-benzylpiperazin-1-yl)ethylcarbamoylamino]-3H-benzimidazol-5-yl] 2,6-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 87123409 |
| Molecular Formula | C27H28Cl2N6O4S |
| Molecular Weight | 603.53 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | [2-[2-(4-benzylpiperazin-1-yl)ethylcarbamoylamino]-3H-benzimidazol-5-yl] 2,6-dichlorobenzenesulfonate |
| SMILES | O=C(NCCN1CCN(Cc2ccccc2)CC1)Nc1nc2ccc(OS(=O)(=O)c3c(Cl)cccc3Cl)cc2[nH]1 |
| InChI | InChI=1S/C27H28Cl2N6O4S/c28-21-7-4-8-22(29)25(21)40(37,38)39-20-9-10-23-24(17-20)32-26(31-23)33-27(36)30-11-12-34-13-15-35(16-14-34)18-19-5-2-1-3-6-19/h1-10,17H,11-16,18H2,(H3,30,31,32,33,36) |
| InChIKey | SQQZYBZSWMAANR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 119.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|