C16H23N5O2 — CID 167881883
1-(1H-benzimidazol-2-yl)-3-[2-(2,6-dimethylmorpholin-4-yl)ethyl]urea (PubChem CID 167881883) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)-3-[2-(2,6-dimethylmorpholin-4-yl)ethyl]urea.
| Compound Name | 1-(1H-benzimidazol-2-yl)-3-[2-(2,6-dimethylmorpholin-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 167881883 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)-3-[2-(2,6-dimethylmorpholin-4-yl)ethyl]urea |
| SMILES | CC1CN(CCNC(=O)Nc2nc3ccccc3[nH]2)CC(C)O1 |
| InChI | InChI=1S/C16H23N5O2/c1-11-9-21(10-12(2)23-11)8-7-17-16(22)20-15-18-13-5-3-4-6-14(13)19-15/h3-6,11-12H,7-10H2,1-2H3,(H3,17,18,19,20,22) |
| InChIKey | GIAWNULPAQAXPV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |