C15H26N6O2 — CID 154774201
1-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea (PubChem CID 154774201) has the molecular formula C15H26N6O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea.
| Compound Name | 1-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea |
|---|---|
| PubChem CID | 154774201 |
| Molecular Formula | C15H26N6O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea |
| SMILES | CC1CN(CCNC(=O)NCCNc2ncccn2)CC(C)O1 |
| InChI | InChI=1S/C15H26N6O2/c1-12-10-21(11-13(2)23-12)9-8-20-15(22)19-7-6-18-14-16-4-3-5-17-14/h3-5,12-13H,6-11H2,1-2H3,(H,16,17,18)(H2,19,20,22) |
| InChIKey | SNTQFHZORBIOIH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|