C14H25N3O2 — CID 97225657
1-cyclopent-3-en-1-yl-3-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]urea (PubChem CID 97225657) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-cyclopent-3-en-1-yl-3-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]urea.
| Compound Name | 1-cyclopent-3-en-1-yl-3-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 97225657 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 1-cyclopent-3-en-1-yl-3-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]urea |
| SMILES | C[C@@H]1CN(CCNC(=O)NC2CC=CC2)C[C@H](C)O1 |
| InChI | InChI=1S/C14H25N3O2/c1-11-9-17(10-12(2)19-11)8-7-15-14(18)16-13-5-3-4-6-13/h3-4,11-13H,5-10H2,1-2H3,(H2,15,16,18)/t11-,12+ |
| InChIKey | RNTVSRRMGSIXOD-TXEJJXNPSA-N |
| XLogP | 1.11 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|